C16H26FN3O — CID 155070839
4-[(3Z,5Z)-3-fluoro-5-(piperazin-1-ylmethyl)hepta-1,3,5-trien-4-yl]morpholine (PubChem CID 155070839) has the molecular formula C16H26FN3O and a molecular weight of 295.40 g/mol. Its IUPAC name is 4-[(3Z,5Z)-3-fluoro-5-(piperazin-1-ylmethyl)hepta-1,3,5-trien-4-yl]morpholine.
| Compound Name | 4-[(3Z,5Z)-3-fluoro-5-(piperazin-1-ylmethyl)hepta-1,3,5-trien-4-yl]morpholine |
|---|---|
| PubChem CID | 155070839 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 4-[(3Z,5Z)-3-fluoro-5-(piperazin-1-ylmethyl)hepta-1,3,5-trien-4-yl]morpholine |
| SMILES | C=C/C(F)=C(C(=C/C)\CN1CCNCC1)/N1CCOCC1 |
| InChI | InChI=1S/C16H26FN3O/c1-3-14(13-19-7-5-18-6-8-19)16(15(17)4-2)20-9-11-21-12-10-20/h3-4,18H,2,5-13H2,1H3/b14-3-,16-15- |
| InChIKey | DVFBLTJSRZBWCM-YLRCWISRSA-N |
| XLogP | 1.54 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|