C18H33N — CID 155070922
N-[(2Z,4Z)-6,6,8,8,11-pentamethyldodeca-2,4-dien-5-yl]methanimine (PubChem CID 155070922) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is N-[(2Z,4Z)-6,6,8,8,11-pentamethyldodeca-2,4-dien-5-yl]methanimine.
| Compound Name | N-[(2Z,4Z)-6,6,8,8,11-pentamethyldodeca-2,4-dien-5-yl]methanimine |
|---|---|
| PubChem CID | 155070922 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | N-[(2Z,4Z)-6,6,8,8,11-pentamethyldodeca-2,4-dien-5-yl]methanimine |
| SMILES | C=N/C(=C\C=C/C)C(C)(C)CC(C)(C)CCC(C)C |
| InChI | InChI=1S/C18H33N/c1-9-10-11-16(19-8)18(6,7)14-17(4,5)13-12-15(2)3/h9-11,15H,8,12-14H2,1-7H3/b10-9-,16-11- |
| InChIKey | NLJLGTXMVAQZTI-YIEJYADJSA-N |
| XLogP | 6.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|