C10H15NO2 — CID 155071155
N-[(3E,5E)-6-methoxyocta-3,5,7-trien-3-yl]formamide (PubChem CID 155071155) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N-[(3E,5E)-6-methoxyocta-3,5,7-trien-3-yl]formamide.
| Compound Name | N-[(3E,5E)-6-methoxyocta-3,5,7-trien-3-yl]formamide |
|---|---|
| PubChem CID | 155071155 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-[(3E,5E)-6-methoxyocta-3,5,7-trien-3-yl]formamide |
| SMILES | C=C/C(=C\C=C(/CC)NC=O)OC |
| InChI | InChI=1S/C10H15NO2/c1-4-9(11-8-12)6-7-10(5-2)13-3/h5-8H,2,4H2,1,3H3,(H,11,12)/b9-6+,10-7+ |
| InChIKey | PZMPIEKJIQYNBI-KZZDLZNXSA-N |
| XLogP | 1.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|