C22H47N5 — CID 155071905
2-(2,4,4,5-tetramethylhexan-2-yl)-1-[N'-(2,4,4,5-tetramethylhexan-2-yl)carbamimidoyl]guanidine (PubChem CID 155071905) has the molecular formula C22H47N5 and a molecular weight of 381.65 g/mol. Its IUPAC name is 2-(2,4,4,5-tetramethylhexan-2-yl)-1-[N'-(2,4,4,5-tetramethylhexan-2-yl)carbamimidoyl]guanidine.
| Compound Name | 2-(2,4,4,5-tetramethylhexan-2-yl)-1-[N'-(2,4,4,5-tetramethylhexan-2-yl)carbamimidoyl]guanidine |
|---|---|
| PubChem CID | 155071905 |
| Molecular Formula | C22H47N5 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.38 |
| IUPAC Name | 2-(2,4,4,5-tetramethylhexan-2-yl)-1-[N'-(2,4,4,5-tetramethylhexan-2-yl)carbamimidoyl]guanidine |
| SMILES | CC(C)C(C)(C)CC(C)(C)/N=C(\N)N/C(N)=N/C(C)(C)CC(C)(C)C(C)C |
| InChI | InChI=1S/C22H47N5/c1-15(2)19(5,6)13-21(9,10)26-17(23)25-18(24)27-22(11,12)14-20(7,8)16(3)4/h15-16H,13-14H2,1-12H3,(H5,23,24,25,26,27) |
| InChIKey | QALSEINMUWHCIG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|