C10H17N3 — CID 155072453
N'-[(2Z,4Z)-3-(1-aminoethenyl)-4-methylhexa-2,4-dien-2-yl]methanimidamide (PubChem CID 155072453) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is N'-[(2Z,4Z)-3-(1-aminoethenyl)-4-methylhexa-2,4-dien-2-yl]methanimidamide.
| Compound Name | N'-[(2Z,4Z)-3-(1-aminoethenyl)-4-methylhexa-2,4-dien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 155072453 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | N'-[(2Z,4Z)-3-(1-aminoethenyl)-4-methylhexa-2,4-dien-2-yl]methanimidamide |
| SMILES | C=C(N)C(/C(C)=C\C)=C(C)\N=C\N |
| InChI | InChI=1S/C10H17N3/c1-5-7(2)10(8(3)12)9(4)13-6-11/h5-6H,3,12H2,1-2,4H3,(H2,11,13)/b7-5-,10-9- |
| InChIKey | MHGVAMZENQKYRC-XGOROQTFSA-N |
| XLogP | 1.69 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|