About N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine
N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine (PubChem CID 155072707) has the molecular formula C13H26FN3
and a molecular weight of 243.37 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine |
| PubChem CID | 155072707 |
| Molecular Formula | C13H26FN3 |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.21 |
| IUPAC Name | N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine |
| SMILES | C=C(F)/C=C(\CCC)NCCCCNCCN |
| InChI | InChI=1S/C13H26FN3/c1-3-6-13(11-12(2)14)17-9-5-4-8-16-10-7-15/h11,16-17H,2-10,15H2,1H3/b13-11+ |
| InChIKey | KGHNTUCHFKUAIP-ACCUITESSA-N |
| XLogP | 2.07 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine?
The IUPAC name of N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine (CID 155072707) is N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine.
What is the SMILES notation for N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine?
The canonical SMILES for N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine is C=C(F)/C=C(\CCC)NCCCCNCCN.
What is the InChIKey of N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine?
The InChIKey is KGHNTUCHFKUAIP-ACCUITESSA-N. The full InChI is InChI=1S/C13H26FN3/c1-3-6-13(11-12(2)14)17-9-5-4-8-16-10-7-15/h11,16-17H,2-10,15H2,1H3/b13-11+.
What are the key properties of N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine?
N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine has a molecular weight of 243.37 g/mol, XLogP of 2.07, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N'-[(3E)-2-fluorohepta-1,3-dien-4-yl]butane-1,4-diamine is sourced from PubChem (CID 155072707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).