About ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate
ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate (PubChem CID 155072848) has the molecular formula C19H40N2O4S
and a molecular weight of 392.61 g/mol. Its IUPAC name is ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate |
| PubChem CID | 155072848 |
| Molecular Formula | C19H40N2O4S |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate |
| SMILES | CCOC(=O)CCN(CCCN(CCC(=O)OCC)S(C)(C)C)C(C)C |
| InChI | InChI=1S/C19H40N2O4S/c1-8-24-18(22)11-15-20(17(3)4)13-10-14-21(26(5,6)7)16-12-19(23)25-9-2/h17H,8-16H2,1-7H3 |
| InChIKey | HTKFRLKBOQFVJI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate?
The IUPAC name of ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate (CID 155072848) is ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate.
What is the SMILES notation for ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate?
The canonical SMILES for ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate is CCOC(=O)CCN(CCCN(CCC(=O)OCC)S(C)(C)C)C(C)C.
What is the InChIKey of ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate?
The InChIKey is HTKFRLKBOQFVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40N2O4S/c1-8-24-18(22)11-15-20(17(3)4)13-10-14-21(26(5,6)7)16-12-19(23)25-9-2/h17H,8-16H2,1-7H3.
What are the key properties of ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate?
ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate has a molecular weight of 392.61 g/mol, XLogP of 2.90, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[3-[(3-ethoxy-3-oxopropyl)-(trimethyl-λ4-sulfanyl)amino]propyl-propan-2-ylamino]propanoate is sourced from PubChem (CID 155072848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).