C42H76N2 — CID 155073352
4-[(9Z,28Z,31Z)-heptatriaconta-6,7,9,28,31-pentaen-19-yl]imino-N-methylbutan-1-amine (PubChem CID 155073352) has the molecular formula C42H76N2 and a molecular weight of 609.08 g/mol. Its IUPAC name is 4-[(9Z,28Z,31Z)-heptatriaconta-6,7,9,28,31-pentaen-19-yl]imino-N-methylbutan-1-amine.
| Compound Name | 4-[(9Z,28Z,31Z)-heptatriaconta-6,7,9,28,31-pentaen-19-yl]imino-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 155073352 |
| Molecular Formula | C42H76N2 |
| Molecular Weight | 609.08 g/mol |
| Exact Mass | 608.60 |
| IUPAC Name | 4-[(9Z,28Z,31Z)-heptatriaconta-6,7,9,28,31-pentaen-19-yl]imino-N-methylbutan-1-amine |
| SMILES | CCCCCC=C=C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)/N=C/CCCNC |
| InChI | InChI=1S/C42H76N2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-38-42(44-41-37-36-40-43-3)39-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-14,17-21,41-43H,4-11,16,22-40H2,1-3H3/b14-12-,20-18-,21-19-,44-41+ |
| InChIKey | IVMUREPWQPGWKP-VMNHXPMDSA-N |
| XLogP | 13.60 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.08 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|