C24H47NS4 — CID 155073419
N-methyl-3-(methyldisulfanyl)-4-[[(9Z,12Z)-octadeca-9,12-dienyl]disulfanyl]butan-1-amine (PubChem CID 155073419) has the molecular formula C24H47NS4 and a molecular weight of 477.92 g/mol. Its IUPAC name is N-methyl-3-(methyldisulfanyl)-4-[[(9Z,12Z)-octadeca-9,12-dienyl]disulfanyl]butan-1-amine.
| Compound Name | N-methyl-3-(methyldisulfanyl)-4-[[(9Z,12Z)-octadeca-9,12-dienyl]disulfanyl]butan-1-amine |
|---|---|
| PubChem CID | 155073419 |
| Molecular Formula | C24H47NS4 |
| Molecular Weight | 477.92 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-methyl-3-(methyldisulfanyl)-4-[[(9Z,12Z)-octadeca-9,12-dienyl]disulfanyl]butan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCSSCC(CCNC)SSC |
| InChI | InChI=1S/C24H47NS4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-27-28-23-24(29-26-3)20-21-25-2/h8-9,11-12,24-25H,4-7,10,13-23H2,1-3H3/b9-8-,12-11- |
| InChIKey | FNSFROHATNVIDQ-MURFETPASA-N |
| XLogP | 9.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.92 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|