C30H49N — CID 155073468
4-[(8E,10E)-docosa-1,8,10,14,15,16-hexaen-2-yl]-N,N-dimethylcyclohexan-1-amine (PubChem CID 155073468) has the molecular formula C30H49N and a molecular weight of 423.73 g/mol. Its IUPAC name is 4-[(8E,10E)-docosa-1,8,10,14,15,16-hexaen-2-yl]-N,N-dimethylcyclohexan-1-amine.
| Compound Name | 4-[(8E,10E)-docosa-1,8,10,14,15,16-hexaen-2-yl]-N,N-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 155073468 |
| Molecular Formula | C30H49N |
| Molecular Weight | 423.73 g/mol |
| Exact Mass | 423.39 |
| IUPAC Name | 4-[(8E,10E)-docosa-1,8,10,14,15,16-hexaen-2-yl]-N,N-dimethylcyclohexan-1-amine |
| SMILES | C=C(CCCCC/C=C/C=C/CCC=C=C=CCCCCC)C1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C30H49N/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-28(2)29-24-26-30(27-25-29)31(3)4/h9,12,15-18,29-30H,2,5-8,13-14,19-27H2,1,3-4H3/b12-9+,16-15+,18-17+ |
| InChIKey | BJRRJSVMTAMXQY-REBODHAWSA-N |
| XLogP | 8.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.73 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|