About 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide
5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide (PubChem CID 155073571) has the molecular formula C20H17N7O
and a molecular weight of 371.40 g/mol. Its IUPAC name is 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide |
| PubChem CID | 155073571 |
| Molecular Formula | C20H17N7O |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide |
| SMILES | [H]/N=C(\c1ccncc1)c1cc2[nH]c(C(=O)NNc3ccccc3)nc2cc1N |
| InChI | InChI=1S/C20H17N7O/c21-15-11-17-16(10-14(15)18(22)12-6-8-23-9-7-12)24-19(25-17)20(28)27-26-13-4-2-1-3-5-13/h1-11,22,26H,21H2,(H,24,25)(H,27,28)/b22-18+ |
| InChIKey | HYWKXGGMEHDYRK-RELWKKBWSA-N |
| XLogP | 2.71 |
| TPSA | 132.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide?
The IUPAC name of 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide (CID 155073571) is 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide.
What is the SMILES notation for 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide?
The canonical SMILES for 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide is [H]/N=C(\c1ccncc1)c1cc2[nH]c(C(=O)NNc3ccccc3)nc2cc1N.
What is the InChIKey of 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide?
The InChIKey is HYWKXGGMEHDYRK-RELWKKBWSA-N. The full InChI is InChI=1S/C20H17N7O/c21-15-11-17-16(10-14(15)18(22)12-6-8-23-9-7-12)24-19(25-17)20(28)27-26-13-4-2-1-3-5-13/h1-11,22,26H,21H2,(H,24,25)(H,27,28)/b22-18+.
What are the key properties of 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide?
5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide has a molecular weight of 371.40 g/mol, XLogP of 2.71, 5 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N'-phenyl-6-(pyridine-4-carboximidoyl)-1H-benzimidazole-2-carbohydrazide is sourced from PubChem (CID 155073571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).