C10H19NO — CID 15507370
(2S,3S,4R,6S)-2,3-dimethyl-6-[(E)-prop-1-enyl]piperidin-4-ol (PubChem CID 15507370) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (2S,3S,4R,6S)-2,3-dimethyl-6-[(E)-prop-1-enyl]piperidin-4-ol.
| Compound Name | (2S,3S,4R,6S)-2,3-dimethyl-6-[(E)-prop-1-enyl]piperidin-4-ol |
|---|---|
| PubChem CID | 15507370 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (2S,3S,4R,6S)-2,3-dimethyl-6-[(E)-prop-1-enyl]piperidin-4-ol |
| SMILES | C/C=C/[C@@H]1C[C@@H](O)[C@@H](C)[C@H](C)N1 |
| InChI | InChI=1S/C10H19NO/c1-4-5-9-6-10(12)7(2)8(3)11-9/h4-5,7-12H,6H2,1-3H3/b5-4+/t7-,8-,9+,10+/m0/s1 |
| InChIKey | ZVHUJIRVDOGJHH-WPNFBXIZSA-N |
| XLogP | 1.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|