About 2,10b-dihydropyrano[2,3-f]chromene
2,10b-dihydropyrano[2,3-f]chromene (PubChem CID 155075232) has the molecular formula C12H10O2
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2,10b-dihydropyrano[2,3-f]chromene.
Molecular Properties
| Compound Name | 2,10b-dihydropyrano[2,3-f]chromene |
| PubChem CID | 155075232 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 2,10b-dihydropyrano[2,3-f]chromene |
| SMILES | C1=COC2=CC=C3C=CCOC3C2=C1 |
| InChI | InChI=1S/C12H10O2/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1/h1-7,12H,8H2 |
| InChIKey | QFXLTOWRHHQEGA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,10b-dihydropyrano[2,3-f]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,10b-dihydropyrano[2,3-f]chromene?
The IUPAC name of 2,10b-dihydropyrano[2,3-f]chromene (CID 155075232) is 2,10b-dihydropyrano[2,3-f]chromene.
What is the SMILES notation for 2,10b-dihydropyrano[2,3-f]chromene?
The canonical SMILES for 2,10b-dihydropyrano[2,3-f]chromene is C1=COC2=CC=C3C=CCOC3C2=C1.
What is the InChIKey of 2,10b-dihydropyrano[2,3-f]chromene?
The InChIKey is QFXLTOWRHHQEGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2/c1-3-9-5-6-11-10(4-2-7-13-11)12(9)14-8-1/h1-7,12H,8H2.
What are the key properties of 2,10b-dihydropyrano[2,3-f]chromene?
2,10b-dihydropyrano[2,3-f]chromene has a molecular weight of 186.21 g/mol, XLogP of 2.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10b-dihydropyrano[2,3-f]chromene is sourced from PubChem (CID 155075232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).