About 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate
2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate (PubChem CID 155075364) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate.
Molecular Properties
| Compound Name | 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate |
| PubChem CID | 155075364 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate |
| SMILES | CC(C)(OC(=O)CC1CCCCC1)C1CCNCC1 |
| InChI | InChI=1S/C16H29NO2/c1-16(2,14-8-10-17-11-9-14)19-15(18)12-13-6-4-3-5-7-13/h13-14,17H,3-12H2,1-2H3 |
| InChIKey | DOZIPSSFSKYDJR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate?
The IUPAC name of 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate (CID 155075364) is 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate.
What is the SMILES notation for 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate?
The canonical SMILES for 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate is CC(C)(OC(=O)CC1CCCCC1)C1CCNCC1.
What is the InChIKey of 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate?
The InChIKey is DOZIPSSFSKYDJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO2/c1-16(2,14-8-10-17-11-9-14)19-15(18)12-13-6-4-3-5-7-13/h13-14,17H,3-12H2,1-2H3.
What are the key properties of 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate?
2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate has a molecular weight of 267.41 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylpropan-2-yl 2-cyclohexylacetate is sourced from PubChem (CID 155075364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).