C20H16O — CID 15507546
(3E,5E)-6-anthracen-9-ylhexa-3,5-dien-2-one (PubChem CID 15507546) has the molecular formula C20H16O and a molecular weight of 272.35 g/mol. Its IUPAC name is (3E,5E)-6-anthracen-9-ylhexa-3,5-dien-2-one.
| Compound Name | (3E,5E)-6-anthracen-9-ylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 15507546 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (3E,5E)-6-anthracen-9-ylhexa-3,5-dien-2-one |
| SMILES | CC(=O)/C=C/C=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C20H16O/c1-15(21)8-2-5-13-20-18-11-6-3-9-16(18)14-17-10-4-7-12-19(17)20/h2-14H,1H3/b8-2+,13-5+ |
| InChIKey | OEUNGPZDZKTTIX-SYTBPBFKSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|