About bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate
bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate (PubChem CID 155075481) has the molecular formula C28H46N2O4
and a molecular weight of 474.69 g/mol. Its IUPAC name is bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate |
| PubChem CID | 155075481 |
| Molecular Formula | C28H46N2O4 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate |
| SMILES | CC(C)(OC(=O)C12CC3CC(C1)CC(C(=O)OC(C)(C)C1CCNCC1)(C3)C2)C1CCNCC1 |
| InChI | InChI=1S/C28H46N2O4/c1-25(2,21-5-9-29-10-6-21)33-23(31)27-14-19-13-20(15-27)17-28(16-19,18-27)24(32)34-26(3,4)22-7-11-30-12-8-22/h19-22,29-30H,5-18H2,1-4H3 |
| InChIKey | MXHLAEOHBVDWQM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate?
The IUPAC name of bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate (CID 155075481) is bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate.
What is the SMILES notation for bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate?
The canonical SMILES for bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate is CC(C)(OC(=O)C12CC3CC(C1)CC(C(=O)OC(C)(C)C1CCNCC1)(C3)C2)C1CCNCC1.
What is the InChIKey of bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate?
The InChIKey is MXHLAEOHBVDWQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H46N2O4/c1-25(2,21-5-9-29-10-6-21)33-23(31)27-14-19-13-20(15-27)17-28(16-19,18-27)24(32)34-26(3,4)22-7-11-30-12-8-22/h19-22,29-30H,5-18H2,1-4H3.
What are the key properties of bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate?
bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate has a molecular weight of 474.69 g/mol, XLogP of 4.22, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-piperidin-4-ylpropan-2-yl) adamantane-1,3-dicarboxylate is sourced from PubChem (CID 155075481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).