About 2-piperidin-4-ylpropan-2-yl nonanoate
2-piperidin-4-ylpropan-2-yl nonanoate (PubChem CID 155075507) has the molecular formula C17H33NO2
and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl nonanoate.
Molecular Properties
| Compound Name | 2-piperidin-4-ylpropan-2-yl nonanoate |
| PubChem CID | 155075507 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl nonanoate |
| SMILES | CCCCCCCCC(=O)OC(C)(C)C1CCNCC1 |
| InChI | InChI=1S/C17H33NO2/c1-4-5-6-7-8-9-10-16(19)20-17(2,3)15-11-13-18-14-12-15/h15,18H,4-14H2,1-3H3 |
| InChIKey | GPPGPABXMYXNDU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-4-ylpropan-2-yl nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-ylpropan-2-yl nonanoate?
The IUPAC name of 2-piperidin-4-ylpropan-2-yl nonanoate (CID 155075507) is 2-piperidin-4-ylpropan-2-yl nonanoate.
What is the SMILES notation for 2-piperidin-4-ylpropan-2-yl nonanoate?
The canonical SMILES for 2-piperidin-4-ylpropan-2-yl nonanoate is CCCCCCCCC(=O)OC(C)(C)C1CCNCC1.
What is the InChIKey of 2-piperidin-4-ylpropan-2-yl nonanoate?
The InChIKey is GPPGPABXMYXNDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO2/c1-4-5-6-7-8-9-10-16(19)20-17(2,3)15-11-13-18-14-12-15/h15,18H,4-14H2,1-3H3.
What are the key properties of 2-piperidin-4-ylpropan-2-yl nonanoate?
2-piperidin-4-ylpropan-2-yl nonanoate has a molecular weight of 283.46 g/mol, XLogP of 4.06, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylpropan-2-yl nonanoate is sourced from PubChem (CID 155075507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).