About 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate
2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate (PubChem CID 155075532) has the molecular formula C18H27NO5
and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate.
Molecular Properties
| Compound Name | 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate |
| PubChem CID | 155075532 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)OC(C)(C)C2CCNCC2)cc(OC)c1O |
| InChI | InChI=1S/C18H27NO5/c1-18(2,13-5-7-19-8-6-13)24-16(20)11-12-9-14(22-3)17(21)15(10-12)23-4/h9-10,13,19,21H,5-8,11H2,1-4H3 |
| InChIKey | QEIQCWMCMQMCDR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate?
The IUPAC name of 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate (CID 155075532) is 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate.
What is the SMILES notation for 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate?
The canonical SMILES for 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate is COc1cc(CC(=O)OC(C)(C)C2CCNCC2)cc(OC)c1O.
What is the InChIKey of 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate?
The InChIKey is QEIQCWMCMQMCDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO5/c1-18(2,13-5-7-19-8-6-13)24-16(20)11-12-9-14(22-3)17(21)15(10-12)23-4/h9-10,13,19,21H,5-8,11H2,1-4H3.
What are the key properties of 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate?
2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate has a molecular weight of 337.42 g/mol, XLogP of 2.27, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylpropan-2-yl 2-(4-hydroxy-3,5-dimethoxyphenyl)acetate is sourced from PubChem (CID 155075532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).