About 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate
2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate (PubChem CID 155075557) has the molecular formula C18H33NO2
and a molecular weight of 295.47 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate.
Molecular Properties
| Compound Name | 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate |
| PubChem CID | 155075557 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate |
| SMILES | CC(C)=CCCC(C)CC(=O)OC(C)(C)C1CCNCC1 |
| InChI | InChI=1S/C18H33NO2/c1-14(2)7-6-8-15(3)13-17(20)21-18(4,5)16-9-11-19-12-10-16/h7,15-16,19H,6,8-13H2,1-5H3 |
| InChIKey | PZNLKYJHDLQJDJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate?
The IUPAC name of 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate (CID 155075557) is 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate.
What is the SMILES notation for 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate?
The canonical SMILES for 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate is CC(C)=CCCC(C)CC(=O)OC(C)(C)C1CCNCC1.
What is the InChIKey of 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate?
The InChIKey is PZNLKYJHDLQJDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33NO2/c1-14(2)7-6-8-15(3)13-17(20)21-18(4,5)16-9-11-19-12-10-16/h7,15-16,19H,6,8-13H2,1-5H3.
What are the key properties of 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate?
2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate has a molecular weight of 295.47 g/mol, XLogP of 4.08, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylpropan-2-yl 3,7-dimethyloct-6-enoate is sourced from PubChem (CID 155075557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).