About bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate
bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate (PubChem CID 155075567) has the molecular formula C23H42N2O4
and a molecular weight of 410.60 g/mol. Its IUPAC name is bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate.
Molecular Properties
| Compound Name | bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate |
| PubChem CID | 155075567 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate |
| SMILES | CC(CCC(=O)OC(C)(C)C1CCNCC1)CC(=O)OC(C)(C)C1CCNCC1 |
| InChI | InChI=1S/C23H42N2O4/c1-17(16-21(27)29-23(4,5)19-10-14-25-15-11-19)6-7-20(26)28-22(2,3)18-8-12-24-13-9-18/h17-19,24-25H,6-16H2,1-5H3 |
| InChIKey | HCORUEDXJAFRSX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate?
The IUPAC name of bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate (CID 155075567) is bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate.
What is the SMILES notation for bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate?
The canonical SMILES for bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate is CC(CCC(=O)OC(C)(C)C1CCNCC1)CC(=O)OC(C)(C)C1CCNCC1.
What is the InChIKey of bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate?
The InChIKey is HCORUEDXJAFRSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H42N2O4/c1-17(16-21(27)29-23(4,5)19-10-14-25-15-11-19)6-7-20(26)28-22(2,3)18-8-12-24-13-9-18/h17-19,24-25H,6-16H2,1-5H3.
What are the key properties of bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate?
bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate has a molecular weight of 410.60 g/mol, XLogP of 3.44, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-piperidin-4-ylpropan-2-yl) 3-methylhexanedioate is sourced from PubChem (CID 155075567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).