About 2-piperidin-4-ylpropan-2-yl undec-10-enoate
2-piperidin-4-ylpropan-2-yl undec-10-enoate (PubChem CID 155075597) has the molecular formula C19H35NO2
and a molecular weight of 309.49 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl undec-10-enoate.
Molecular Properties
| Compound Name | 2-piperidin-4-ylpropan-2-yl undec-10-enoate |
| PubChem CID | 155075597 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OC(C)(C)C1CCNCC1 |
| InChI | InChI=1S/C19H35NO2/c1-4-5-6-7-8-9-10-11-12-18(21)22-19(2,3)17-13-15-20-16-14-17/h4,17,20H,1,5-16H2,2-3H3 |
| InChIKey | IVIVULWLGWSQBU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-4-ylpropan-2-yl undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-ylpropan-2-yl undec-10-enoate?
The IUPAC name of 2-piperidin-4-ylpropan-2-yl undec-10-enoate (CID 155075597) is 2-piperidin-4-ylpropan-2-yl undec-10-enoate.
What is the SMILES notation for 2-piperidin-4-ylpropan-2-yl undec-10-enoate?
The canonical SMILES for 2-piperidin-4-ylpropan-2-yl undec-10-enoate is C=CCCCCCCCCC(=O)OC(C)(C)C1CCNCC1.
What is the InChIKey of 2-piperidin-4-ylpropan-2-yl undec-10-enoate?
The InChIKey is IVIVULWLGWSQBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H35NO2/c1-4-5-6-7-8-9-10-11-12-18(21)22-19(2,3)17-13-15-20-16-14-17/h4,17,20H,1,5-16H2,2-3H3.
What are the key properties of 2-piperidin-4-ylpropan-2-yl undec-10-enoate?
2-piperidin-4-ylpropan-2-yl undec-10-enoate has a molecular weight of 309.49 g/mol, XLogP of 4.61, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylpropan-2-yl undec-10-enoate is sourced from PubChem (CID 155075597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).