C27H49NO2 — CID 155075609
2-piperidin-4-ylpropan-2-yl (10Z,13E)-nonadeca-10,13-dienoate (PubChem CID 155075609) has the molecular formula C27H49NO2 and a molecular weight of 419.69 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl (10Z,13E)-nonadeca-10,13-dienoate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl (10Z,13E)-nonadeca-10,13-dienoate |
|---|---|
| PubChem CID | 155075609 |
| Molecular Formula | C27H49NO2 |
| Molecular Weight | 419.69 g/mol |
| Exact Mass | 419.38 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl (10Z,13E)-nonadeca-10,13-dienoate |
| SMILES | CCCCC/C=C/C/C=C\CCCCCCCCC(=O)OC(C)(C)C1CCNCC1 |
| InChI | InChI=1S/C27H49NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26(29)30-27(2,3)25-21-23-28-24-22-25/h8-9,11-12,25,28H,4-7,10,13-24H2,1-3H3/b9-8+,12-11- |
| InChIKey | YKEXBHVPWYOKFP-UPDVNHGHSA-N |
| XLogP | 7.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.69 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|