About bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate
bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate (PubChem CID 155075622) has the molecular formula C26H44N2O4
and a molecular weight of 448.65 g/mol. Its IUPAC name is bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate |
| PubChem CID | 155075622 |
| Molecular Formula | C26H44N2O4 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate |
| SMILES | CC(C)(OC(=O)C12CCC(C(=O)OC(C)(C)C3CCNCC3)(CC1)CC2)C1CCNCC1 |
| InChI | InChI=1S/C26H44N2O4/c1-23(2,19-5-15-27-16-6-19)31-21(29)25-9-12-26(13-10-25,14-11-25)22(30)32-24(3,4)20-7-17-28-18-8-20/h19-20,27-28H,5-18H2,1-4H3 |
| InChIKey | CQMMKAUUPPSDPL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate?
The IUPAC name of bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate (CID 155075622) is bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate.
What is the SMILES notation for bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate?
The canonical SMILES for bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate is CC(C)(OC(=O)C12CCC(C(=O)OC(C)(C)C3CCNCC3)(CC1)CC2)C1CCNCC1.
What is the InChIKey of bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate?
The InChIKey is CQMMKAUUPPSDPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H44N2O4/c1-23(2,19-5-15-27-16-6-19)31-21(29)25-9-12-26(13-10-25,14-11-25)22(30)32-24(3,4)20-7-17-28-18-8-20/h19-20,27-28H,5-18H2,1-4H3.
What are the key properties of bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate?
bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate has a molecular weight of 448.65 g/mol, XLogP of 3.97, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-piperidin-4-ylpropan-2-yl) bicyclo[2.2.2]octane-1,4-dicarboxylate is sourced from PubChem (CID 155075622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).