About 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate
2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate (PubChem CID 155075748) has the molecular formula C26H49NO2
and a molecular weight of 407.68 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate.
Molecular Properties
| Compound Name | 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate |
| PubChem CID | 155075748 |
| Molecular Formula | C26H49NO2 |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 407.38 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OC(C)(C)C1CCNCC1 |
| InChI | InChI=1S/C26H49NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)29-26(2,3)24-20-22-27-23-21-24/h11-12,24,27H,4-10,13-23H2,1-3H3/b12-11+ |
| InChIKey | MAHHSACVZQCLMU-VAWYXSNFSA-N |
| XLogP | 7.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate?
The IUPAC name of 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate (CID 155075748) is 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate.
What is the SMILES notation for 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate?
The canonical SMILES for 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate is CCCCCCCC/C=C/CCCCCCCC(=O)OC(C)(C)C1CCNCC1.
What is the InChIKey of 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate?
The InChIKey is MAHHSACVZQCLMU-VAWYXSNFSA-N. The full InChI is InChI=1S/C26H49NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)29-26(2,3)24-20-22-27-23-21-24/h11-12,24,27H,4-10,13-23H2,1-3H3/b12-11+.
What are the key properties of 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate?
2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate has a molecular weight of 407.68 g/mol, XLogP of 7.35, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylpropan-2-yl (E)-octadec-9-enoate is sourced from PubChem (CID 155075748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).