C31H35NO6 — CID 155076005
cyclobutyl-[2-methyl-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]methanone (PubChem CID 155076005) has the molecular formula C31H35NO6 and a molecular weight of 517.62 g/mol. Its IUPAC name is cyclobutyl-[2-methyl-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]methanone.
| Compound Name | cyclobutyl-[2-methyl-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 155076005 |
| Molecular Formula | C31H35NO6 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | cyclobutyl-[2-methyl-7-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-yl]methanone |
| SMILES | Cc1ccc2c(c1)C1(CCN(C(=O)C3CCC3)CC1)c1cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc1-2 |
| InChI | InChI=1S/C31H35NO6/c1-18-5-8-21-22-9-6-19(7-10-25-27(34)29(36)28(35)26(17-33)38-25)16-24(22)31(23(21)15-18)11-13-32(14-12-31)30(37)20-3-2-4-20/h5-6,8-9,15-16,20,25-29,33-36H,2-4,11-14,17H2,1H3/t25-,26-,27-,28-,29-/m1/s1 |
| InChIKey | KCDRFHLFMSIMDC-HWVUQVAQSA-N |
| XLogP | 1.88 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|