C19H20O2 — CID 155076011
(1S,2R)-2',7'-dimethylspiro[cyclopentane-4,9'-fluorene]-1,2-diol (PubChem CID 155076011) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (1S,2R)-2',7'-dimethylspiro[cyclopentane-4,9'-fluorene]-1,2-diol.
| Compound Name | (1S,2R)-2',7'-dimethylspiro[cyclopentane-4,9'-fluorene]-1,2-diol |
|---|---|
| PubChem CID | 155076011 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (1S,2R)-2',7'-dimethylspiro[cyclopentane-4,9'-fluorene]-1,2-diol |
| SMILES | Cc1ccc2c(c1)C1(C[C@@H](O)[C@@H](O)C1)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C19H20O2/c1-11-3-5-13-14-6-4-12(2)8-16(14)19(15(13)7-11)9-17(20)18(21)10-19/h3-8,17-18,20-21H,9-10H2,1-2H3/t17-,18+ |
| InChIKey | FVYOWGXXCRIVBR-HDICACEKSA-N |
| XLogP | 3.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |