C26H35ClN2O4 — CID 155076213
N-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-6-methoxy-3-[(E)-methoxyiminomethyl]-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]formamide (PubChem CID 155076213) has the molecular formula C26H35ClN2O4 and a molecular weight of 475.03 g/mol. Its IUPAC name is N-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-6-methoxy-3-[(E)-methoxyiminomethyl]-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]formamide.
| Compound Name | N-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-6-methoxy-3-[(E)-methoxyiminomethyl]-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]formamide |
|---|---|
| PubChem CID | 155076213 |
| Molecular Formula | C26H35ClN2O4 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-[(2R,3R,4R)-3-[(1E,3E)-5-[5-chloro-2-hydroxy-6-methoxy-3-[(E)-methoxyiminomethyl]-4-methylphenyl]-3-methylpenta-1,3-dienyl]-2,3,4-trimethylcyclohexylidene]formamide |
| SMILES | CO/N=C/c1c(C)c(Cl)c(OC)c(C/C=C(C)/C=C/[C@@]2(C)[C@H](C)CC/C(=N\C=O)[C@@H]2C)c1O |
| InChI | InChI=1S/C26H35ClN2O4/c1-16(12-13-26(5)17(2)9-11-22(19(26)4)28-15-30)8-10-20-24(31)21(14-29-33-7)18(3)23(27)25(20)32-6/h8,12-15,17,19,31H,9-11H2,1-7H3/b13-12+,16-8+,28-22+,29-14+/t17-,19+,26+/m1/s1 |
| InChIKey | CPORGJZQXVWFLM-HEZHHCRKSA-N |
| XLogP | 6.06 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|