C24H35NO3 — CID 15507625
tert-butyl (2R,4R)-2-(3-methylnona-1,2-dienyl)-4-phenyl-1,3-oxazolidine-3-carboxylate (PubChem CID 15507625) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-(3-methylnona-1,2-dienyl)-4-phenyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-(3-methylnona-1,2-dienyl)-4-phenyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15507625 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | tert-butyl (2R,4R)-2-(3-methylnona-1,2-dienyl)-4-phenyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCCCC(C)=C=C[C@H]1OC[C@@H](c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H35NO3/c1-6-7-8-10-13-19(2)16-17-22-25(23(26)28-24(3,4)5)21(18-27-22)20-14-11-9-12-15-20/h9,11-12,14-15,17,21-22H,6-8,10,13,18H2,1-5H3/t16?,21-,22+/m0/s1 |
| InChIKey | QLSLQXAIIBJHQB-APFNHRKESA-N |
| XLogP | 6.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|