C22H23Cl2FN4O4 — CID 155076352
5-chloro-N'-[1-[[3-(4-chloro-3-fluorophenoxy)-2-hydroxypropyl]amino]pyrrolidin-3-yl]-1-benzofuran-2-carbohydrazide (PubChem CID 155076352) has the molecular formula C22H23Cl2FN4O4 and a molecular weight of 497.35 g/mol. Its IUPAC name is 5-chloro-N'-[1-[[3-(4-chloro-3-fluorophenoxy)-2-hydroxypropyl]amino]pyrrolidin-3-yl]-1-benzofuran-2-carbohydrazide.
| Compound Name | 5-chloro-N'-[1-[[3-(4-chloro-3-fluorophenoxy)-2-hydroxypropyl]amino]pyrrolidin-3-yl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 155076352 |
| Molecular Formula | C22H23Cl2FN4O4 |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 5-chloro-N'-[1-[[3-(4-chloro-3-fluorophenoxy)-2-hydroxypropyl]amino]pyrrolidin-3-yl]-1-benzofuran-2-carbohydrazide |
| SMILES | O=C(NNC1CCN(NCC(O)COc2ccc(Cl)c(F)c2)C1)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C22H23Cl2FN4O4/c23-14-1-4-20-13(7-14)8-21(33-20)22(31)28-27-15-5-6-29(11-15)26-10-16(30)12-32-17-2-3-18(24)19(25)9-17/h1-4,7-9,15-16,26-27,30H,5-6,10-12H2,(H,28,31) |
| InChIKey | PVXOBVQDKUHCPX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|