C10H6F12O4 — CID 15507721
1,1,1,2,6,6,7,7,7-nonafluoro-5,5-dimethoxy-2-(trifluoromethyl)heptane-3,4-dione (PubChem CID 15507721) has the molecular formula C10H6F12O4 and a molecular weight of 418.13 g/mol. Its IUPAC name is 1,1,1,2,6,6,7,7,7-nonafluoro-5,5-dimethoxy-2-(trifluoromethyl)heptane-3,4-dione.
| Compound Name | 1,1,1,2,6,6,7,7,7-nonafluoro-5,5-dimethoxy-2-(trifluoromethyl)heptane-3,4-dione |
|---|---|
| PubChem CID | 15507721 |
| Molecular Formula | C10H6F12O4 |
| Molecular Weight | 418.13 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 1,1,1,2,6,6,7,7,7-nonafluoro-5,5-dimethoxy-2-(trifluoromethyl)heptane-3,4-dione |
| SMILES | COC(OC)(C(=O)C(=O)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F12O4/c1-25-6(26-2,7(12,13)10(20,21)22)4(24)3(23)5(11,8(14,15)16)9(17,18)19/h1-2H3 |
| InChIKey | YZYQBRYZEVEVEO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|