About (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol
(3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol (PubChem CID 155077299) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol.
Molecular Properties
| Compound Name | (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol |
| PubChem CID | 155077299 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol |
| SMILES | O[C@@H]1COCCCC12Cc1ccccc1C2 |
| InChI | InChI=1S/C14H18O2/c15-13-10-16-7-3-6-14(13)8-11-4-1-2-5-12(11)9-14/h1-2,4-5,13,15H,3,6-10H2/t13-/m1/s1 |
| InChIKey | DUPOBGMHKCWFAR-CYBMUJFWSA-N |
| XLogP | 1.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol?
The IUPAC name of (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol (CID 155077299) is (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol.
What is the SMILES notation for (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol?
The canonical SMILES for (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol is O[C@@H]1COCCCC12Cc1ccccc1C2.
What is the InChIKey of (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol?
The InChIKey is DUPOBGMHKCWFAR-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H18O2/c15-13-10-16-7-3-6-14(13)8-11-4-1-2-5-12(11)9-14/h1-2,4-5,13,15H,3,6-10H2/t13-/m1/s1.
What are the key properties of (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol?
(3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol has a molecular weight of 218.30 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3'S)-spiro[1,3-dihydroindene-2,4'-oxepane]-3'-ol is sourced from PubChem (CID 155077299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).