About [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate
[(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate (PubChem CID 155077304) has the molecular formula C35H36O5S
and a molecular weight of 568.74 g/mol. Its IUPAC name is [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate.
Molecular Properties
| Compound Name | [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate |
| PubChem CID | 155077304 |
| Molecular Formula | C35H36O5S |
| Molecular Weight | 568.74 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate |
| SMILES | O=C(CC(c1ccccc1)S(=O)(=O)c1ccccc1)O[C@@H]1COCCCC1(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C35H36O5S/c36-34(24-32(30-18-9-3-10-19-30)41(37,38)31-20-11-4-12-21-31)40-33-27-39-23-13-22-35(33,25-28-14-5-1-6-15-28)26-29-16-7-2-8-17-29/h1-12,14-21,32-33H,13,22-27H2/t32?,33-/m1/s1 |
| InChIKey | ZDWFYHLHKZEGFG-ZHZZGXISSA-N |
| XLogP | 6.79 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.74 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate?
The IUPAC name of [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate (CID 155077304) is [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate.
What is the SMILES notation for [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate?
The canonical SMILES for [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate is O=C(CC(c1ccccc1)S(=O)(=O)c1ccccc1)O[C@@H]1COCCCC1(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate?
The InChIKey is ZDWFYHLHKZEGFG-ZHZZGXISSA-N. The full InChI is InChI=1S/C35H36O5S/c36-34(24-32(30-18-9-3-10-19-30)41(37,38)31-20-11-4-12-21-31)40-33-27-39-23-13-22-35(33,25-28-14-5-1-6-15-28)26-29-16-7-2-8-17-29/h1-12,14-21,32-33H,13,22-27H2/t32?,33-/m1/s1.
What are the key properties of [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate?
[(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate has a molecular weight of 568.74 g/mol, XLogP of 6.79, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-4,4-dibenzyloxepan-3-yl] 3-(benzenesulfonyl)-3-phenylpropanoate is sourced from PubChem (CID 155077304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).