About (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene
(Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene (PubChem CID 15507746) has the molecular formula C7H12F2O
and a molecular weight of 150.17 g/mol. Its IUPAC name is (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene.
Molecular Properties
| Compound Name | (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene |
| PubChem CID | 15507746 |
| Molecular Formula | C7H12F2O |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene |
| SMILES | CCOCC(C)/C(F)=C/F |
| InChI | InChI=1S/C7H12F2O/c1-3-10-5-6(2)7(9)4-8/h4,6H,3,5H2,1-2H3/b7-4- |
| InChIKey | LYGTVZCJCYVRSD-DAXSKMNVSA-N |
| XLogP | 2.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene?
The IUPAC name of (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene (CID 15507746) is (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene.
What is the SMILES notation for (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene?
The canonical SMILES for (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene is CCOCC(C)/C(F)=C/F.
What is the InChIKey of (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene?
The InChIKey is LYGTVZCJCYVRSD-DAXSKMNVSA-N. The full InChI is InChI=1S/C7H12F2O/c1-3-10-5-6(2)7(9)4-8/h4,6H,3,5H2,1-2H3/b7-4-.
What are the key properties of (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene?
(Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene has a molecular weight of 150.17 g/mol, XLogP of 2.44, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-ethoxy-1,2-difluoro-3-methylbut-1-ene is sourced from PubChem (CID 15507746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).