C18H24OS — CID 15507835
1-[(1S,2S)-2-methoxy-2-[(2E)-penta-2,4-dienyl]cyclopentyl]sulfanyl-4-methylbenzene (PubChem CID 15507835) has the molecular formula C18H24OS and a molecular weight of 288.46 g/mol. Its IUPAC name is 1-[(1S,2S)-2-methoxy-2-[(2E)-penta-2,4-dienyl]cyclopentyl]sulfanyl-4-methylbenzene.
| Compound Name | 1-[(1S,2S)-2-methoxy-2-[(2E)-penta-2,4-dienyl]cyclopentyl]sulfanyl-4-methylbenzene |
|---|---|
| PubChem CID | 15507835 |
| Molecular Formula | C18H24OS |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-[(1S,2S)-2-methoxy-2-[(2E)-penta-2,4-dienyl]cyclopentyl]sulfanyl-4-methylbenzene |
| SMILES | C=C/C=C/C[C@@]1(OC)CCC[C@@H]1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C18H24OS/c1-4-5-6-13-18(19-3)14-7-8-17(18)20-16-11-9-15(2)10-12-16/h4-6,9-12,17H,1,7-8,13-14H2,2-3H3/b6-5+/t17-,18+/m0/s1 |
| InChIKey | SJNQPRPIOVUIJG-HQYUYXFKSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|