C27H17N3 — CID 155079126
4-[4-(4-naphthalen-1-ylphenyl)pyrimidin-2-yl]benzonitrile (PubChem CID 155079126) has the molecular formula C27H17N3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[4-(4-naphthalen-1-ylphenyl)pyrimidin-2-yl]benzonitrile.
| Compound Name | 4-[4-(4-naphthalen-1-ylphenyl)pyrimidin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 155079126 |
| Molecular Formula | C27H17N3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 4-[4-(4-naphthalen-1-ylphenyl)pyrimidin-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nccc(-c3ccc(-c4cccc5ccccc45)cc3)n2)cc1 |
| InChI | InChI=1S/C27H17N3/c28-18-19-8-10-23(11-9-19)27-29-17-16-26(30-27)22-14-12-21(13-15-22)25-7-3-5-20-4-1-2-6-24(20)25/h1-17H |
| InChIKey | OIPVZIXUYJGITN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |