C45H28N4 — CID 155080366
4-carbazol-9-yl-3-[4-[5-cyano-2-(6,7-didehydro-8H-cyclohepta[b]indol-5-yl)phenyl]cyclohexa-1,3-dien-1-yl]benzonitrile (PubChem CID 155080366) has the molecular formula C45H28N4 and a molecular weight of 624.75 g/mol. Its IUPAC name is 4-carbazol-9-yl-3-[4-[5-cyano-2-(6,7-didehydro-8H-cyclohepta[b]indol-5-yl)phenyl]cyclohexa-1,3-dien-1-yl]benzonitrile.
| Compound Name | 4-carbazol-9-yl-3-[4-[5-cyano-2-(6,7-didehydro-8H-cyclohepta[b]indol-5-yl)phenyl]cyclohexa-1,3-dien-1-yl]benzonitrile |
|---|---|
| PubChem CID | 155080366 |
| Molecular Formula | C45H28N4 |
| Molecular Weight | 624.75 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 4-carbazol-9-yl-3-[4-[5-cyano-2-(6,7-didehydro-8H-cyclohepta[b]indol-5-yl)phenyl]cyclohexa-1,3-dien-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(-n2c3c(c4ccccc42)C=CCC#C3)c(C2=CC=C(c3cc(C#N)ccc3-n3c4ccccc4c4ccccc43)CC2)c1 |
| InChI | InChI=1S/C45H28N4/c46-28-30-18-24-44(48-40-14-3-1-2-10-34(40)35-11-4-7-15-41(35)48)38(26-30)32-20-22-33(23-21-32)39-27-31(29-47)19-25-45(39)49-42-16-8-5-12-36(42)37-13-6-9-17-43(37)49/h2,4-13,15-20,22,24-27H,1,21,23H2 |
| InChIKey | FEXCSRORIGEATB-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.75 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|