About tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate
tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate (PubChem CID 155082314) has the molecular formula C15H25NO3
and a molecular weight of 267.37 g/mol. Its IUPAC name is tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate |
| PubChem CID | 155082314 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate |
| SMILES | C=CN(C(=O)OC(C)(C)C)/C(C)=C/C(=C\CC)OC |
| InChI | InChI=1S/C15H25NO3/c1-8-10-13(18-7)11-12(3)16(9-2)14(17)19-15(4,5)6/h9-11H,2,8H2,1,3-7H3/b12-11+,13-10+ |
| InChIKey | AXPIRENAFUONLZ-JASOSIDASA-N |
| XLogP | 4.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate?
The IUPAC name of tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate (CID 155082314) is tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate?
The canonical SMILES for tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate is C=CN(C(=O)OC(C)(C)C)/C(C)=C/C(=C\CC)OC.
What is the InChIKey of tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate?
The InChIKey is AXPIRENAFUONLZ-JASOSIDASA-N. The full InChI is InChI=1S/C15H25NO3/c1-8-10-13(18-7)11-12(3)16(9-2)14(17)19-15(4,5)6/h9-11H,2,8H2,1,3-7H3/b12-11+,13-10+.
What are the key properties of tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate?
tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate has a molecular weight of 267.37 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-ethenyl-N-[(2E,4E)-4-methoxyhepta-2,4-dien-2-yl]carbamate is sourced from PubChem (CID 155082314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).