C18H31F4N — CID 155082561
(E)-N-[(Z)-4,4-difluoro-5-methylhex-2-en-2-yl]-4,4-difluoro-3,6,7-trimethyloct-5-en-1-amine (PubChem CID 155082561) has the molecular formula C18H31F4N and a molecular weight of 337.45 g/mol. Its IUPAC name is (E)-N-[(Z)-4,4-difluoro-5-methylhex-2-en-2-yl]-4,4-difluoro-3,6,7-trimethyloct-5-en-1-amine.
| Compound Name | (E)-N-[(Z)-4,4-difluoro-5-methylhex-2-en-2-yl]-4,4-difluoro-3,6,7-trimethyloct-5-en-1-amine |
|---|---|
| PubChem CID | 155082561 |
| Molecular Formula | C18H31F4N |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | (E)-N-[(Z)-4,4-difluoro-5-methylhex-2-en-2-yl]-4,4-difluoro-3,6,7-trimethyloct-5-en-1-amine |
| SMILES | C/C(=C/C(F)(F)C(C)C)NCCC(C)C(F)(F)/C=C(\C)C(C)C |
| InChI | InChI=1S/C18H31F4N/c1-12(2)14(5)10-18(21,22)15(6)8-9-23-16(7)11-17(19,20)13(3)4/h10-13,15,23H,8-9H2,1-7H3/b14-10+,16-11- |
| InChIKey | BKFPAMZXKGVYIF-DECHVDIESA-N |
| XLogP | 6.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|