About 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide
4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide (PubChem CID 15508343) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide.
Molecular Properties
| Compound Name | 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide |
| PubChem CID | 15508343 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide |
| SMILES | CC(=O)N1CCNC=C1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H19N3O2/c1-8(15)14-6-5-12-7-9(14)10(16)13-11(2,3)4/h7,12H,5-6H2,1-4H3,(H,13,16) |
| InChIKey | ZGSJHMDDXJMCGR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide?
The IUPAC name of 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide (CID 15508343) is 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide.
What is the SMILES notation for 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide?
The canonical SMILES for 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide is CC(=O)N1CCNC=C1C(=O)NC(C)(C)C.
What is the InChIKey of 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide?
The InChIKey is ZGSJHMDDXJMCGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-8(15)14-6-5-12-7-9(14)10(16)13-11(2,3)4/h7,12H,5-6H2,1-4H3,(H,13,16).
What are the key properties of 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide?
4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide has a molecular weight of 225.29 g/mol, XLogP of 0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-tert-butyl-2,3-dihydro-1H-pyrazine-5-carboxamide is sourced from PubChem (CID 15508343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).