C21H18F3N5O5 — CID 155083586
2-[2-[[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carbonyl]amino]ethoxy]acetic acid (PubChem CID 155083586) has the molecular formula C21H18F3N5O5 and a molecular weight of 477.40 g/mol. Its IUPAC name is 2-[2-[[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carbonyl]amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carbonyl]amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 155083586 |
| Molecular Formula | C21H18F3N5O5 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 2-[2-[[1-methyl-2-[[6-(trifluoromethyl)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carbonyl]amino]ethoxy]acetic acid |
| SMILES | Cn1c(Nc2nc3ccc(C(F)(F)F)cc3o2)nc2cc(C(=O)NCCOCC(=O)O)ccc21 |
| InChI | InChI=1S/C21H18F3N5O5/c1-29-15-5-2-11(18(32)25-6-7-33-10-17(30)31)8-14(15)26-19(29)28-20-27-13-4-3-12(21(22,23)24)9-16(13)34-20/h2-5,8-9H,6-7,10H2,1H3,(H,25,32)(H,30,31)(H,26,27,28) |
| InChIKey | AOPQPHLHQIZBNJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|