C21H20F3N5O4 — CID 155083613
N-(2-methoxyethyl)-1-methyl-2-[[6-(2,2,2-trifluoroethoxy)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide (PubChem CID 155083613) has the molecular formula C21H20F3N5O4 and a molecular weight of 463.42 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-methyl-2-[[6-(2,2,2-trifluoroethoxy)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-methyl-2-[[6-(2,2,2-trifluoroethoxy)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155083613 |
| Molecular Formula | C21H20F3N5O4 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-(2-methoxyethyl)-1-methyl-2-[[6-(2,2,2-trifluoroethoxy)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(OCC(F)(F)F)cc3o1)n2C |
| InChI | InChI=1S/C21H20F3N5O4/c1-29-16-6-3-12(18(30)25-7-8-31-2)9-15(16)26-19(29)28-20-27-14-5-4-13(10-17(14)33-20)32-11-21(22,23)24/h3-6,9-10H,7-8,11H2,1-2H3,(H,25,30)(H,26,27,28) |
| InChIKey | QZVLAWMTHUDPAC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|