C19H23N5O3S — CID 155083630
N-(2-hydroxyethoxy)-1-methyl-2-[(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]benzimidazole-5-carboxamide (PubChem CID 155083630) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-(2-hydroxyethoxy)-1-methyl-2-[(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]benzimidazole-5-carboxamide.
| Compound Name | N-(2-hydroxyethoxy)-1-methyl-2-[(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155083630 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-(2-hydroxyethoxy)-1-methyl-2-[(6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)amino]benzimidazole-5-carboxamide |
| SMILES | CC1CCc2nc(Nc3nc4cc(C(=O)NOCCO)ccc4n3C)sc2C1 |
| InChI | InChI=1S/C19H23N5O3S/c1-11-3-5-13-16(9-11)28-19(21-13)22-18-20-14-10-12(4-6-15(14)24(18)2)17(26)23-27-8-7-25/h4,6,10-11,25H,3,5,7-9H2,1-2H3,(H,23,26)(H,20,21,22) |
| InChIKey | AYQDTPVFIOTZJH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|