C20H20FN5O4 — CID 155083654
2-(1,3-benzoxazol-2-ylamino)-6-fluoro-N-[2-(2-hydroxyethoxy)ethyl]-1-methylbenzimidazole-5-carboxamide (PubChem CID 155083654) has the molecular formula C20H20FN5O4 and a molecular weight of 413.41 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylamino)-6-fluoro-N-[2-(2-hydroxyethoxy)ethyl]-1-methylbenzimidazole-5-carboxamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylamino)-6-fluoro-N-[2-(2-hydroxyethoxy)ethyl]-1-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155083654 |
| Molecular Formula | C20H20FN5O4 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylamino)-6-fluoro-N-[2-(2-hydroxyethoxy)ethyl]-1-methylbenzimidazole-5-carboxamide |
| SMILES | Cn1c(Nc2nc3ccccc3o2)nc2cc(C(=O)NCCOCCO)c(F)cc21 |
| InChI | InChI=1S/C20H20FN5O4/c1-26-16-11-13(21)12(18(28)22-6-8-29-9-7-27)10-15(16)23-19(26)25-20-24-14-4-2-3-5-17(14)30-20/h2-5,10-11,27H,6-9H2,1H3,(H,22,28)(H,23,24,25) |
| InChIKey | CZXKQLONCKQBDK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|