C22H22F3N5O5 — CID 155083693
N,1-bis(2-methoxyethyl)-2-[[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide (PubChem CID 155083693) has the molecular formula C22H22F3N5O5 and a molecular weight of 493.44 g/mol. Its IUPAC name is N,1-bis(2-methoxyethyl)-2-[[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide.
| Compound Name | N,1-bis(2-methoxyethyl)-2-[[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155083693 |
| Molecular Formula | C22H22F3N5O5 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N,1-bis(2-methoxyethyl)-2-[[6-(trifluoromethoxy)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(OC(F)(F)F)cc3o1)n2CCOC |
| InChI | InChI=1S/C22H22F3N5O5/c1-32-9-7-26-19(31)13-3-6-17-16(11-13)27-20(30(17)8-10-33-2)29-21-28-15-5-4-14(12-18(15)34-21)35-22(23,24)25/h3-6,11-12H,7-10H2,1-2H3,(H,26,31)(H,27,28,29) |
| InChIKey | PBTOZLIJPXZNCA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 112.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|