C22H22F3N5O4 — CID 155083715
N-[2-(2-hydroxypropoxy)ethyl]-1-methyl-2-[[6-(trifluoromethyl)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide (PubChem CID 155083715) has the molecular formula C22H22F3N5O4 and a molecular weight of 477.44 g/mol. Its IUPAC name is N-[2-(2-hydroxypropoxy)ethyl]-1-methyl-2-[[6-(trifluoromethyl)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide.
| Compound Name | N-[2-(2-hydroxypropoxy)ethyl]-1-methyl-2-[[6-(trifluoromethyl)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 155083715 |
| Molecular Formula | C22H22F3N5O4 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N-[2-(2-hydroxypropoxy)ethyl]-1-methyl-2-[[6-(trifluoromethyl)-1,3-benzoxazol-2-yl]amino]benzimidazole-5-carboxamide |
| SMILES | CC(O)COCCNC(=O)c1ccc2c(c1)nc(Nc1nc3ccc(C(F)(F)F)cc3o1)n2C |
| InChI | InChI=1S/C22H22F3N5O4/c1-12(31)11-33-8-7-26-19(32)13-3-6-17-16(9-13)27-20(30(17)2)29-21-28-15-5-4-14(22(23,24)25)10-18(15)34-21/h3-6,9-10,12,31H,7-8,11H2,1-2H3,(H,26,32)(H,27,28,29) |
| InChIKey | OVSGSJXZFGNNIB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|