C26H28I2N4O3S — CID 155084150
(2R,4S)-N-[[6-(diiodoamino)-2-pyridinyl]sulfonyl]-4-phenyl-1-[(2,4,6-trimethylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 155084150) has the molecular formula C26H28I2N4O3S and a molecular weight of 730.41 g/mol. Its IUPAC name is (2R,4S)-N-[[6-(diiodoamino)-2-pyridinyl]sulfonyl]-4-phenyl-1-[(2,4,6-trimethylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-[[6-(diiodoamino)-2-pyridinyl]sulfonyl]-4-phenyl-1-[(2,4,6-trimethylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155084150 |
| Molecular Formula | C26H28I2N4O3S |
| Molecular Weight | 730.41 g/mol |
| Exact Mass | 730.00 |
| IUPAC Name | (2R,4S)-N-[[6-(diiodoamino)-2-pyridinyl]sulfonyl]-4-phenyl-1-[(2,4,6-trimethylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1cc(C)c(CN2C[C@H](c3ccccc3)C[C@@H]2C(=O)NS(=O)(=O)c2cccc(N(I)I)n2)c(C)c1 |
| InChI | InChI=1S/C26H28I2N4O3S/c1-17-12-18(2)22(19(3)13-17)16-31-15-21(20-8-5-4-6-9-20)14-23(31)26(33)30-36(34,35)25-11-7-10-24(29-25)32(27)28/h4-13,21,23H,14-16H2,1-3H3,(H,30,33)/t21-,23-/m1/s1 |
| InChIKey | USNKXDLTQOWTKO-FYYLOGMGSA-N |
| XLogP | 5.38 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|