C29H43N5O5S — CID 155084211
N-[(6-amino-2-pyridinyl)sulfonyl]-6-tert-butyl-5-[(1R,2R)-2-cyclopentyl-1,2-dihydroxyethyl]-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]pyridine-3-carboxamide (PubChem CID 155084211) has the molecular formula C29H43N5O5S and a molecular weight of 573.76 g/mol. Its IUPAC name is N-[(6-amino-2-pyridinyl)sulfonyl]-6-tert-butyl-5-[(1R,2R)-2-cyclopentyl-1,2-dihydroxyethyl]-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-[(6-amino-2-pyridinyl)sulfonyl]-6-tert-butyl-5-[(1R,2R)-2-cyclopentyl-1,2-dihydroxyethyl]-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155084211 |
| Molecular Formula | C29H43N5O5S |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | N-[(6-amino-2-pyridinyl)sulfonyl]-6-tert-butyl-5-[(1R,2R)-2-cyclopentyl-1,2-dihydroxyethyl]-2-[(4S)-2,2,4-trimethylpyrrolidin-1-yl]pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2nc(C(C)(C)C)c([C@@H](O)[C@H](O)C3CCCC3)cc2C(=O)NS(=O)(=O)c2cccc(N)n2)C(C)(C)C1 |
| InChI | InChI=1S/C29H43N5O5S/c1-17-15-29(5,6)34(16-17)26-20(27(37)33-40(38,39)22-13-9-12-21(30)31-22)14-19(25(32-26)28(2,3)4)24(36)23(35)18-10-7-8-11-18/h9,12-14,17-18,23-24,35-36H,7-8,10-11,15-16H2,1-6H3,(H2,30,31)(H,33,37)/t17-,23+,24+/m0/s1 |
| InChIKey | XFAYXRVFIAMXSG-PKKBDPGCSA-N |
| XLogP | 3.68 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |