C23H35N — CID 155084486
(4Z)-8-ethyl-4-ethylidene-10-(7-methylcyclohepta-1,4,6-trien-1-yl)-3-methylidenedecan-2-imine (PubChem CID 155084486) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is (4Z)-8-ethyl-4-ethylidene-10-(7-methylcyclohepta-1,4,6-trien-1-yl)-3-methylidenedecan-2-imine.
| Compound Name | (4Z)-8-ethyl-4-ethylidene-10-(7-methylcyclohepta-1,4,6-trien-1-yl)-3-methylidenedecan-2-imine |
|---|---|
| PubChem CID | 155084486 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | (4Z)-8-ethyl-4-ethylidene-10-(7-methylcyclohepta-1,4,6-trien-1-yl)-3-methylidenedecan-2-imine |
| SMILES | [H]/N=C(\C)C(=C)/C(=C\C)CCCC(CC)CCC1=CCC=CC=C1C |
| InChI | InChI=1S/C23H35N/c1-6-21(13-11-15-22(7-2)19(4)20(5)24)16-17-23-14-10-8-9-12-18(23)3/h7-9,12,14,21,24H,4,6,10-11,13,15-17H2,1-3,5H3/b22-7-,24-20+ |
| InChIKey | FNVNKGKFRFQFFF-UDBMWSPPSA-N |
| XLogP | 7.34 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|