C12H16N2 — CID 155084622
1-methyl-3-(6-methylcyclohepta-2,4-dien-1-yl)pyrazole (PubChem CID 155084622) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-methyl-3-(6-methylcyclohepta-2,4-dien-1-yl)pyrazole.
| Compound Name | 1-methyl-3-(6-methylcyclohepta-2,4-dien-1-yl)pyrazole |
|---|---|
| PubChem CID | 155084622 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-methyl-3-(6-methylcyclohepta-2,4-dien-1-yl)pyrazole |
| SMILES | CC1C=CC=CC(c2ccn(C)n2)C1 |
| InChI | InChI=1S/C12H16N2/c1-10-5-3-4-6-11(9-10)12-7-8-14(2)13-12/h3-8,10-11H,9H2,1-2H3 |
| InChIKey | PUWZNZPIGXYGGJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |