C50H26F3IN6 — CID 155085131
3-[2,6-difluoro-4-[4-[3-fluoro-5-iodo-4-(1,10-phenanthrolin-3-yl)phenyl]-6-naphthalen-2-ylpyrimidin-2-yl]phenyl]-1,10-phenanthroline (PubChem CID 155085131) has the molecular formula C50H26F3IN6 and a molecular weight of 894.70 g/mol. Its IUPAC name is 3-[2,6-difluoro-4-[4-[3-fluoro-5-iodo-4-(1,10-phenanthrolin-3-yl)phenyl]-6-naphthalen-2-ylpyrimidin-2-yl]phenyl]-1,10-phenanthroline.
| Compound Name | 3-[2,6-difluoro-4-[4-[3-fluoro-5-iodo-4-(1,10-phenanthrolin-3-yl)phenyl]-6-naphthalen-2-ylpyrimidin-2-yl]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 155085131 |
| Molecular Formula | C50H26F3IN6 |
| Molecular Weight | 894.70 g/mol |
| Exact Mass | 894.12 |
| IUPAC Name | 3-[2,6-difluoro-4-[4-[3-fluoro-5-iodo-4-(1,10-phenanthrolin-3-yl)phenyl]-6-naphthalen-2-ylpyrimidin-2-yl]phenyl]-1,10-phenanthroline |
| SMILES | Fc1cc(-c2nc(-c3cc(F)c(-c4cnc5c(ccc6cccnc65)c4)c(I)c3)cc(-c3ccc4ccccc4c3)n2)cc(F)c1-c1cnc2c(ccc3cccnc32)c1 |
| InChI | InChI=1S/C50H26F3IN6/c51-38-21-35(22-39(52)44(38)36-18-32-13-10-28-7-3-15-55-46(28)48(32)57-25-36)50-59-42(31-12-9-27-5-1-2-6-30(27)17-31)24-43(60-50)34-20-40(53)45(41(54)23-34)37-19-33-14-11-29-8-4-16-56-47(29)49(33)58-26-37/h1-26H |
| InChIKey | TVPDBTMIRGLICK-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.70 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|